C16H19Cl2N3 — CID 62892052
5-chloro-6-[[(2-chlorophenyl)methyl-methylamino]methyl]-N-ethylpyridin-2-amine (PubChem CID 62892052) has the molecular formula C16H19Cl2N3 and a molecular weight of 324.26 g/mol. Its IUPAC name is 5-chloro-6-[[(2-chlorophenyl)methyl-methylamino]methyl]-N-ethylpyridin-2-amine.
| Compound Name | 5-chloro-6-[[(2-chlorophenyl)methyl-methylamino]methyl]-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 62892052 |
| Molecular Formula | C16H19Cl2N3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 5-chloro-6-[[(2-chlorophenyl)methyl-methylamino]methyl]-N-ethylpyridin-2-amine |
| SMILES | CCNc1ccc(Cl)c(CN(C)Cc2ccccc2Cl)n1 |
| InChI | InChI=1S/C16H19Cl2N3/c1-3-19-16-9-8-14(18)15(20-16)11-21(2)10-12-6-4-5-7-13(12)17/h4-9H,3,10-11H2,1-2H3,(H,19,20) |
| InChIKey | PMUCUSWCWFCVLD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |