C8H7BrN4S — CID 80850623
5-bromo-4-N-thiophen-3-ylpyrimidine-2,4-diamine (PubChem CID 80850623) has the molecular formula C8H7BrN4S and a molecular weight of 271.14 g/mol. Its IUPAC name is 5-bromo-4-N-thiophen-3-ylpyrimidine-2,4-diamine.
| Compound Name | 5-bromo-4-N-thiophen-3-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80850623 |
| Molecular Formula | C8H7BrN4S |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 269.96 |
| IUPAC Name | 5-bromo-4-N-thiophen-3-ylpyrimidine-2,4-diamine |
| SMILES | Nc1ncc(Br)c(Nc2ccsc2)n1 |
| InChI | InChI=1S/C8H7BrN4S/c9-6-3-11-8(10)13-7(6)12-5-1-2-14-4-5/h1-4H,(H3,10,11,12,13) |
| InChIKey | IEEHRUDNECUPHD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |