C13H10BrN5O2 — CID 80749350
5-[(2-amino-5-bromopyrimidin-4-yl)amino]-2-methylisoindole-1,3-dione (PubChem CID 80749350) has the molecular formula C13H10BrN5O2 and a molecular weight of 348.16 g/mol. Its IUPAC name is 5-[(2-amino-5-bromopyrimidin-4-yl)amino]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[(2-amino-5-bromopyrimidin-4-yl)amino]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 80749350 |
| Molecular Formula | C13H10BrN5O2 |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 5-[(2-amino-5-bromopyrimidin-4-yl)amino]-2-methylisoindole-1,3-dione |
| SMILES | CN1C(=O)c2ccc(Nc3nc(N)ncc3Br)cc2C1=O |
| InChI | InChI=1S/C13H10BrN5O2/c1-19-11(20)7-3-2-6(4-8(7)12(19)21)17-10-9(14)5-16-13(15)18-10/h2-5H,1H3,(H3,15,16,17,18) |
| InChIKey | DWEGCFTUIXWJLK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|