C11H19BrN4 — CID 80841053
5-bromo-4-N-(3-ethylpentan-3-yl)pyrimidine-2,4-diamine (PubChem CID 80841053) has the molecular formula C11H19BrN4 and a molecular weight of 287.20 g/mol. Its IUPAC name is 5-bromo-4-N-(3-ethylpentan-3-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-4-N-(3-ethylpentan-3-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80841053 |
| Molecular Formula | C11H19BrN4 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 5-bromo-4-N-(3-ethylpentan-3-yl)pyrimidine-2,4-diamine |
| SMILES | CCC(CC)(CC)Nc1nc(N)ncc1Br |
| InChI | InChI=1S/C11H19BrN4/c1-4-11(5-2,6-3)16-9-8(12)7-14-10(13)15-9/h7H,4-6H2,1-3H3,(H3,13,14,15,16) |
| InChIKey | UKTLBRSJHABHKQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |