About 3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol
3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol (PubChem CID 106179448) has the molecular formula C7H9BrF2N4O
and a molecular weight of 283.08 g/mol. Its IUPAC name is 3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol.
Molecular Properties
| Compound Name | 3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol |
| PubChem CID | 106179448 |
| Molecular Formula | C7H9BrF2N4O |
| Molecular Weight | 283.08 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol |
| SMILES | Nc1ncc(Br)c(NCC(F)(F)CO)n1 |
| InChI | InChI=1S/C7H9BrF2N4O/c8-4-1-12-6(11)14-5(4)13-2-7(9,10)3-15/h1,15H,2-3H2,(H3,11,12,13,14) |
| InChIKey | IWFHWUDNEJQHTQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.08 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol?
The IUPAC name of 3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol (CID 106179448) is 3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol.
What is the SMILES notation for 3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol?
The canonical SMILES for 3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol is Nc1ncc(Br)c(NCC(F)(F)CO)n1.
What is the InChIKey of 3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol?
The InChIKey is IWFHWUDNEJQHTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrF2N4O/c8-4-1-12-6(11)14-5(4)13-2-7(9,10)3-15/h1,15H,2-3H2,(H3,11,12,13,14).
What are the key properties of 3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol?
3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol has a molecular weight of 283.08 g/mol, XLogP of 0.86, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-amino-5-bromopyrimidin-4-yl)amino]-2,2-difluoropropan-1-ol is sourced from PubChem (CID 106179448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).