C16H23N5O3 — CID 112940044
5-N-butyl-3-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112940044) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 5-N-butyl-3-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-butyl-3-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112940044 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 5-N-butyl-3-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CCCCNc1cnnc(Nc2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C16H23N5O3/c1-5-6-7-17-14-10-18-21-16(20-14)19-11-8-12(22-2)15(24-4)13(9-11)23-3/h8-10H,5-7H2,1-4H3,(H2,17,19,20,21) |
| InChIKey | MYHCRNUEMWSKQB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|