C26H28N6O3 — CID 122296823
N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 122296823) has the molecular formula C26H28N6O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 122296823 |
| Molecular Formula | C26H28N6O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CCN(CC)c1cc(Nc2ccc(NC(=O)C(C)N3C(=O)c4ccccc4C3=O)cc2)nc(C)n1 |
| InChI | InChI=1S/C26H28N6O3/c1-5-31(6-2)23-15-22(27-17(4)28-23)29-18-11-13-19(14-12-18)30-24(33)16(3)32-25(34)20-9-7-8-10-21(20)26(32)35/h7-16H,5-6H2,1-4H3,(H,30,33)(H,27,28,29) |
| InChIKey | MBOXEFMEGQCDMA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|