C25H19N3O3 — CID 51975698
(2R)-2-(1,3-dioxoisoindol-2-yl)-N-(2-methylbenzo[h]quinolin-4-yl)propanamide (PubChem CID 51975698) has the molecular formula C25H19N3O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-N-(2-methylbenzo[h]quinolin-4-yl)propanamide.
| Compound Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-N-(2-methylbenzo[h]quinolin-4-yl)propanamide |
|---|---|
| PubChem CID | 51975698 |
| Molecular Formula | C25H19N3O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-N-(2-methylbenzo[h]quinolin-4-yl)propanamide |
| SMILES | Cc1cc(NC(=O)[C@@H](C)N2C(=O)c3ccccc3C2=O)c2ccc3ccccc3c2n1 |
| InChI | InChI=1S/C25H19N3O3/c1-14-13-21(20-12-11-16-7-3-4-8-17(16)22(20)26-14)27-23(29)15(2)28-24(30)18-9-5-6-10-19(18)25(28)31/h3-13,15H,1-2H3,(H,26,27,29)/t15-/m1/s1 |
| InChIKey | CCXJVJOOFXTSGY-OAHLLOKOSA-N |
| XLogP | 4.32 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|