C7H5F3N4OS — CID 108763051
2,2,2-trifluoro-N-(6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)acetamide (PubChem CID 108763051) has the molecular formula C7H5F3N4OS and a molecular weight of 250.21 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)acetamide |
|---|---|
| PubChem CID | 108763051 |
| Molecular Formula | C7H5F3N4OS |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 2,2,2-trifluoro-N-(6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)acetamide |
| SMILES | Cc1csc2nc(NC(=O)C(F)(F)F)nn12 |
| InChI | InChI=1S/C7H5F3N4OS/c1-3-2-16-6-12-5(13-14(3)6)11-4(15)7(8,9)10/h2H,1H3,(H,11,13,15) |
| InChIKey | ZIYRAFYROMCFON-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |