C18H22N4O2S — CID 108763111
4-hexoxy-N-(6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)benzamide (PubChem CID 108763111) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 4-hexoxy-N-(6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)benzamide.
| Compound Name | 4-hexoxy-N-(6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)benzamide |
|---|---|
| PubChem CID | 108763111 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-hexoxy-N-(6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2nc3scc(C)n3n2)cc1 |
| InChI | InChI=1S/C18H22N4O2S/c1-3-4-5-6-11-24-15-9-7-14(8-10-15)16(23)19-17-20-18-22(21-17)13(2)12-25-18/h7-10,12H,3-6,11H2,1-2H3,(H,19,21,23) |
| InChIKey | QMECMQZBAJUGRL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|