C16H20N6O4S — CID 19611078
N-[2-(diaminomethylideneamino)ethyl]-2-[(3,4-dimethoxybenzoyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 19611078) has the molecular formula C16H20N6O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)ethyl]-2-[(3,4-dimethoxybenzoyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(diaminomethylideneamino)ethyl]-2-[(3,4-dimethoxybenzoyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 19611078 |
| Molecular Formula | C16H20N6O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[2-(diaminomethylideneamino)ethyl]-2-[(3,4-dimethoxybenzoyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2nc(C(=O)NCCN=C(N)N)cs2)cc1OC |
| InChI | InChI=1S/C16H20N6O4S/c1-25-11-4-3-9(7-12(11)26-2)13(23)22-16-21-10(8-27-16)14(24)19-5-6-20-15(17)18/h3-4,7-8H,5-6H2,1-2H3,(H,19,24)(H4,17,18,20)(H,21,22,23) |
| InChIKey | TVYBPFZEICYOBY-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 153.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|