C22H23N3O4S — CID 18568011
N-[4-[2-(2-ethylanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-3,4-dimethoxybenzamide (PubChem CID 18568011) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-[4-[2-(2-ethylanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-[2-(2-ethylanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 18568011 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-[4-[2-(2-ethylanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-3,4-dimethoxybenzamide |
| SMILES | CCc1ccccc1NC(=O)Cc1csc(NC(=O)c2ccc(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C22H23N3O4S/c1-4-14-7-5-6-8-17(14)24-20(26)12-16-13-30-22(23-16)25-21(27)15-9-10-18(28-2)19(11-15)29-3/h5-11,13H,4,12H2,1-3H3,(H,24,26)(H,23,25,27) |
| InChIKey | QZMISURLTPDZLE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |