C10H10N4O2S — CID 3910053
N-(4-amino-1,2,5-oxadiazol-3-yl)-2-phenylsulfanylacetamide (PubChem CID 3910053) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is N-(4-amino-1,2,5-oxadiazol-3-yl)-2-phenylsulfanylacetamide.
| Compound Name | N-(4-amino-1,2,5-oxadiazol-3-yl)-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 3910053 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | N-(4-amino-1,2,5-oxadiazol-3-yl)-2-phenylsulfanylacetamide |
| SMILES | Nc1nonc1NC(=O)CSc1ccccc1 |
| InChI | InChI=1S/C10H10N4O2S/c11-9-10(14-16-13-9)12-8(15)6-17-7-4-2-1-3-5-7/h1-5H,6H2,(H2,11,13)(H,12,14,15) |
| InChIKey | CKXDATNNTJBOAR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |