C18H21N5O4 — CID 8639224
4-amino-N-[2-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 8639224) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is 4-amino-N-[2-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[2-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 8639224 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 4-amino-N-[2-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | C[C@H](O)c1ccc(-c2ccc(CNCCNC(=O)c3nonc3N)o2)cc1 |
| InChI | InChI=1S/C18H21N5O4/c1-11(24)12-2-4-13(5-3-12)15-7-6-14(26-15)10-20-8-9-21-18(25)16-17(19)23-27-22-16/h2-7,11,20,24H,8-10H2,1H3,(H2,19,23)(H,21,25)/t11-/m0/s1 |
| InChIKey | XSDGKEVGPALGKH-NSHDSACASA-N |
| XLogP | 1.48 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|