C14H20ClN5O3 — CID 2969950
4-amino-N-[2-[(2-ethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride (PubChem CID 2969950) has the molecular formula C14H20ClN5O3 and a molecular weight of 341.80 g/mol. Its IUPAC name is 4-amino-N-[2-[(2-ethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride.
| Compound Name | 4-amino-N-[2-[(2-ethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 2969950 |
| Molecular Formula | C14H20ClN5O3 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-amino-N-[2-[(2-ethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride |
| SMILES | CCOc1ccccc1CNCCNC(=O)c1nonc1N.Cl |
| InChI | InChI=1S/C14H19N5O3.ClH/c1-2-21-11-6-4-3-5-10(11)9-16-7-8-17-14(20)12-13(15)19-22-18-12;/h3-6,16H,2,7-9H2,1H3,(H2,15,19)(H,17,20);1H |
| InChIKey | HKGCNXURJVJANT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|