C21H26ClN5O4 — CID 17292777
4-amino-N-[2-[(3-ethoxy-4-phenylmethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride (PubChem CID 17292777) has the molecular formula C21H26ClN5O4 and a molecular weight of 447.92 g/mol. Its IUPAC name is 4-amino-N-[2-[(3-ethoxy-4-phenylmethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride.
| Compound Name | 4-amino-N-[2-[(3-ethoxy-4-phenylmethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 17292777 |
| Molecular Formula | C21H26ClN5O4 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4-amino-N-[2-[(3-ethoxy-4-phenylmethoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride |
| SMILES | CCOc1cc(CNCCNC(=O)c2nonc2N)ccc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C21H25N5O4.ClH/c1-2-28-18-12-16(8-9-17(18)29-14-15-6-4-3-5-7-15)13-23-10-11-24-21(27)19-20(22)26-30-25-19;/h3-9,12,23H,2,10-11,13-14H2,1H3,(H2,22,26)(H,24,27);1H |
| InChIKey | CJBOHESTDMYEQF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|