C14H20ClN6O2- — CID 21233363
4-amino-N-[2-[[4-(dimethylamino)phenyl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide chloride (PubChem CID 21233363) has the molecular formula C14H20ClN6O2- and a molecular weight of 339.81 g/mol. Its IUPAC name is 4-amino-N-[2-[[4-(dimethylamino)phenyl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide chloride.
| Compound Name | 4-amino-N-[2-[[4-(dimethylamino)phenyl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide chloride |
|---|---|
| PubChem CID | 21233363 |
| Molecular Formula | C14H20ClN6O2- |
| Molecular Weight | 339.81 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-amino-N-[2-[[4-(dimethylamino)phenyl]methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide chloride |
| SMILES | CN(C)c1ccc(CNCCNC(=O)c2nonc2N)cc1.[Cl-] |
| InChI | InChI=1S/C14H20N6O2.ClH/c1-20(2)11-5-3-10(4-6-11)9-16-7-8-17-14(21)12-13(15)19-22-18-12;/h3-6,16H,7-9H2,1-2H3,(H2,15,19)(H,17,21);1H/p-1 |
| InChIKey | ORACQFOLDLGNMI-UHFFFAOYSA-M |
| XLogP | -2.76 |
| TPSA | 109.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.81 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|