C16H21BrClN5O4 — CID 17293212
4-amino-N-[2-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride (PubChem CID 17293212) has the molecular formula C16H21BrClN5O4 and a molecular weight of 462.73 g/mol. Its IUPAC name is 4-amino-N-[2-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride.
| Compound Name | 4-amino-N-[2-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 17293212 |
| Molecular Formula | C16H21BrClN5O4 |
| Molecular Weight | 462.73 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 4-amino-N-[2-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylamino]ethyl]-1,2,5-oxadiazole-3-carboxamide;hydrochloride |
| SMILES | C=CCOc1c(Br)cc(CNCCNC(=O)c2nonc2N)cc1OC.Cl |
| InChI | InChI=1S/C16H20BrN5O4.ClH/c1-3-6-25-14-11(17)7-10(8-12(14)24-2)9-19-4-5-20-16(23)13-15(18)22-26-21-13;/h3,7-8,19H,1,4-6,9H2,2H3,(H2,18,22)(H,20,23);1H |
| InChIKey | SRSUNAQDYLDCAW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.73 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|