C18H24Cl3NO2 — CID 17207840
3-butoxy-N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]propan-1-amine;hydrochloride (PubChem CID 17207840) has the molecular formula C18H24Cl3NO2 and a molecular weight of 392.75 g/mol. Its IUPAC name is 3-butoxy-N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]propan-1-amine;hydrochloride.
| Compound Name | 3-butoxy-N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17207840 |
| Molecular Formula | C18H24Cl3NO2 |
| Molecular Weight | 392.75 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 3-butoxy-N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]propan-1-amine;hydrochloride |
| SMILES | CCCCOCCCNCc1ccc(-c2ccc(Cl)cc2Cl)o1.Cl |
| InChI | InChI=1S/C18H23Cl2NO2.ClH/c1-2-3-10-22-11-4-9-21-13-15-6-8-18(23-15)16-7-5-14(19)12-17(16)20;/h5-8,12,21H,2-4,9-11,13H2,1H3;1H |
| InChIKey | LCGBEPLTXHBUEU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.75 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|