C13H11Cl4NO — CID 106889099
N-[[5-(2,3,4,6-tetrachlorophenyl)furan-2-yl]methyl]ethanamine (PubChem CID 106889099) has the molecular formula C13H11Cl4NO and a molecular weight of 339.05 g/mol. Its IUPAC name is N-[[5-(2,3,4,6-tetrachlorophenyl)furan-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-(2,3,4,6-tetrachlorophenyl)furan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 106889099 |
| Molecular Formula | C13H11Cl4NO |
| Molecular Weight | 339.05 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | N-[[5-(2,3,4,6-tetrachlorophenyl)furan-2-yl]methyl]ethanamine |
| SMILES | CCNCc1ccc(-c2c(Cl)cc(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C13H11Cl4NO/c1-2-18-6-7-3-4-10(19-7)11-8(14)5-9(15)12(16)13(11)17/h3-5,18H,2,6H2,1H3 |
| InChIKey | TXOQVFAMRBIIRS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.05 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|