C11H10Cl3NO — CID 65439392
N-[(4,5,7-trichloro-1-benzofuran-2-yl)methyl]ethanamine (PubChem CID 65439392) has the molecular formula C11H10Cl3NO and a molecular weight of 278.57 g/mol. Its IUPAC name is N-[(4,5,7-trichloro-1-benzofuran-2-yl)methyl]ethanamine.
| Compound Name | N-[(4,5,7-trichloro-1-benzofuran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 65439392 |
| Molecular Formula | C11H10Cl3NO |
| Molecular Weight | 278.57 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | N-[(4,5,7-trichloro-1-benzofuran-2-yl)methyl]ethanamine |
| SMILES | CCNCc1cc2c(Cl)c(Cl)cc(Cl)c2o1 |
| InChI | InChI=1S/C11H10Cl3NO/c1-2-15-5-6-3-7-10(14)8(12)4-9(13)11(7)16-6/h3-4,15H,2,5H2,1H3 |
| InChIKey | HLYCETZXZMJLMC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|