C22H32Cl2N2O — CID 17214757
N',N'-dibutyl-N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]propane-1,3-diamine (PubChem CID 17214757) has the molecular formula C22H32Cl2N2O and a molecular weight of 411.42 g/mol. Its IUPAC name is N',N'-dibutyl-N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]propane-1,3-diamine.
| Compound Name | N',N'-dibutyl-N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 17214757 |
| Molecular Formula | C22H32Cl2N2O |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N',N'-dibutyl-N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]propane-1,3-diamine |
| SMILES | CCCCN(CCCC)CCCNCc1ccc(-c2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C22H32Cl2N2O/c1-3-5-11-26(12-6-4-2)13-7-10-25-17-21-8-9-22(27-21)18-14-19(23)16-20(24)15-18/h8-9,14-16,25H,3-7,10-13,17H2,1-2H3 |
| InChIKey | KXIPUTMJRHWVBX-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|