C12H12Cl2NO+ — CID 7425173
[5-(3,5-dichlorophenyl)furan-2-yl]methyl-methylazanium (PubChem CID 7425173) has the molecular formula C12H12Cl2NO+ and a molecular weight of 257.14 g/mol. Its IUPAC name is [5-(3,5-dichlorophenyl)furan-2-yl]methyl-methylazanium.
| Compound Name | [5-(3,5-dichlorophenyl)furan-2-yl]methyl-methylazanium |
|---|---|
| PubChem CID | 7425173 |
| Molecular Formula | C12H12Cl2NO+ |
| Molecular Weight | 257.14 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | [5-(3,5-dichlorophenyl)furan-2-yl]methyl-methylazanium |
| SMILES | C[NH2+]Cc1ccc(-c2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C12H11Cl2NO/c1-15-7-11-2-3-12(16-11)8-4-9(13)6-10(14)5-8/h2-6,15H,7H2,1H3/p+1 |
| InChIKey | KVRNDHJOFNNVSM-UHFFFAOYSA-O |
| XLogP | 2.95 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.14 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |