C15H17Cl2NO2 — CID 8622634
(2R)-2-[[5-(3,5-dichlorophenyl)furan-2-yl]methylamino]butan-1-ol (PubChem CID 8622634) has the molecular formula C15H17Cl2NO2 and a molecular weight of 314.21 g/mol. Its IUPAC name is (2R)-2-[[5-(3,5-dichlorophenyl)furan-2-yl]methylamino]butan-1-ol.
| Compound Name | (2R)-2-[[5-(3,5-dichlorophenyl)furan-2-yl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 8622634 |
| Molecular Formula | C15H17Cl2NO2 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | (2R)-2-[[5-(3,5-dichlorophenyl)furan-2-yl]methylamino]butan-1-ol |
| SMILES | CC[C@H](CO)NCc1ccc(-c2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C15H17Cl2NO2/c1-2-13(9-19)18-8-14-3-4-15(20-14)10-5-11(16)7-12(17)6-10/h3-7,13,18-19H,2,8-9H2,1H3/t13-/m1/s1 |
| InChIKey | SCKAFJMISVPZKW-CYBMUJFWSA-N |
| XLogP | 4.11 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |