C16H18N2O2S — CID 43215803
2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]butan-1-ol (PubChem CID 43215803) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]butan-1-ol.
| Compound Name | 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 43215803 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]butan-1-ol |
| SMILES | CCC(CO)NCc1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C16H18N2O2S/c1-2-11(10-19)17-9-12-7-8-14(20-12)16-18-13-5-3-4-6-15(13)21-16/h3-8,11,17,19H,2,9-10H2,1H3 |
| InChIKey | XKHJGPHPORUSPZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |