C18H20N2O3S — CID 120510258
2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]hexanoic acid (PubChem CID 120510258) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]hexanoic acid.
| Compound Name | 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]hexanoic acid |
|---|---|
| PubChem CID | 120510258 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]hexanoic acid |
| SMILES | CCCCC(NCc1ccc(-c2nc3ccccc3s2)o1)C(=O)O |
| InChI | InChI=1S/C18H20N2O3S/c1-2-3-6-14(18(21)22)19-11-12-9-10-15(23-12)17-20-13-7-4-5-8-16(13)24-17/h4-5,7-10,14,19H,2-3,6,11H2,1H3,(H,21,22) |
| InChIKey | IOFPTSLQKBGJQE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |