C18H22N4OS — CID 110965982
1-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-3-tert-butyl-2-methylguanidine (PubChem CID 110965982) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is 1-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-3-tert-butyl-2-methylguanidine.
| Compound Name | 1-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-3-tert-butyl-2-methylguanidine |
|---|---|
| PubChem CID | 110965982 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-3-tert-butyl-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(-c2nc3ccccc3s2)o1)NC(C)(C)C |
| InChI | InChI=1S/C18H22N4OS/c1-18(2,3)22-17(19-4)20-11-12-9-10-14(23-12)16-21-13-7-5-6-8-15(13)24-16/h5-10H,11H2,1-4H3,(H2,19,20,22) |
| InChIKey | XNBRKXWMDAKXHX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|