C22H29IN4O2S2 — CID 109440168
1-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide (PubChem CID 109440168) has the molecular formula C22H29IN4O2S2 and a molecular weight of 572.54 g/mol. Its IUPAC name is 1-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109440168 |
| Molecular Formula | C22H29IN4O2S2 |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | 1-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2ccc(-c3nc4ccccc4s3)o2)C1.I |
| InChI | InChI=1S/C22H28N4O2S2.HI/c1-3-30(27)17-8-6-7-15(13-17)25-22(23-2)24-14-16-11-12-19(28-16)21-26-18-9-4-5-10-20(18)29-21;/h4-5,9-12,15,17H,3,6-8,13-14H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | VTJWJJXPZVZGFU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|