About 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol
3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol (PubChem CID 111449592) has the molecular formula C17H20N2O2S2
and a molecular weight of 348.49 g/mol. Its IUPAC name is 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol.
Molecular Properties
| Compound Name | 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol |
| PubChem CID | 111449592 |
| Molecular Formula | C17H20N2O2S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol |
| SMILES | CSCC(CCO)NCc1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C17H20N2O2S2/c1-22-11-12(8-9-20)18-10-13-6-7-15(21-13)17-19-14-4-2-3-5-16(14)23-17/h2-7,12,18,20H,8-11H2,1H3 |
| InChIKey | ASTWINZWAFHTFX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol?
The IUPAC name of 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol (CID 111449592) is 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol.
What is the SMILES notation for 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol?
The canonical SMILES for 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol is CSCC(CCO)NCc1ccc(-c2nc3ccccc3s2)o1.
What is the InChIKey of 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol?
The InChIKey is ASTWINZWAFHTFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O2S2/c1-22-11-12(8-9-20)18-10-13-6-7-15(21-13)17-19-14-4-2-3-5-16(14)23-17/h2-7,12,18,20H,8-11H2,1H3.
What are the key properties of 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol?
3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol has a molecular weight of 348.49 g/mol, XLogP of 3.76, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylamino]-4-methylsulfanylbutan-1-ol is sourced from PubChem (CID 111449592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).