C21H29NO3 — CID 120510242
2-[[5-(4-tert-butylphenyl)furan-2-yl]methylamino]hexanoic acid (PubChem CID 120510242) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)furan-2-yl]methylamino]hexanoic acid.
| Compound Name | 2-[[5-(4-tert-butylphenyl)furan-2-yl]methylamino]hexanoic acid |
|---|---|
| PubChem CID | 120510242 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)furan-2-yl]methylamino]hexanoic acid |
| SMILES | CCCCC(NCc1ccc(-c2ccc(C(C)(C)C)cc2)o1)C(=O)O |
| InChI | InChI=1S/C21H29NO3/c1-5-6-7-18(20(23)24)22-14-17-12-13-19(25-17)15-8-10-16(11-9-15)21(2,3)4/h8-13,18,22H,5-7,14H2,1-4H3,(H,23,24) |
| InChIKey | OFELMQGSBLKDFQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |