C16H18BrNO3S — CID 99124815
(2S)-2-[[5-(4-bromophenyl)furan-2-yl]methylamino]-4-methylsulfanylbutanoic acid (PubChem CID 99124815) has the molecular formula C16H18BrNO3S and a molecular weight of 384.30 g/mol. Its IUPAC name is (2S)-2-[[5-(4-bromophenyl)furan-2-yl]methylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[5-(4-bromophenyl)furan-2-yl]methylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 99124815 |
| Molecular Formula | C16H18BrNO3S |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | (2S)-2-[[5-(4-bromophenyl)furan-2-yl]methylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NCc1ccc(-c2ccc(Br)cc2)o1)C(=O)O |
| InChI | InChI=1S/C16H18BrNO3S/c1-22-9-8-14(16(19)20)18-10-13-6-7-15(21-13)11-2-4-12(17)5-3-11/h2-7,14,18H,8-10H2,1H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | RBNHBVCXTNSHAY-AWEZNQCLSA-N |
| XLogP | 4.01 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |