C17H20FNO3S — CID 99796579
(2R)-2-[[5-(4-fluoro-2-methylphenyl)furan-2-yl]methylamino]-4-methylsulfanylbutanoic acid (PubChem CID 99796579) has the molecular formula C17H20FNO3S and a molecular weight of 337.42 g/mol. Its IUPAC name is (2R)-2-[[5-(4-fluoro-2-methylphenyl)furan-2-yl]methylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[[5-(4-fluoro-2-methylphenyl)furan-2-yl]methylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 99796579 |
| Molecular Formula | C17H20FNO3S |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (2R)-2-[[5-(4-fluoro-2-methylphenyl)furan-2-yl]methylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NCc1ccc(-c2ccc(F)cc2C)o1)C(=O)O |
| InChI | InChI=1S/C17H20FNO3S/c1-11-9-12(18)3-5-14(11)16-6-4-13(22-16)10-19-15(17(20)21)7-8-23-2/h3-6,9,15,19H,7-8,10H2,1-2H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | HABFBAQZJNRXCX-OAHLLOKOSA-N |
| XLogP | 3.69 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |