C19H23NO5 — CID 122044740
(2S)-2-[[5-(2-methoxycarbonylphenyl)furan-2-yl]methylamino]hexanoic acid (PubChem CID 122044740) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is (2S)-2-[[5-(2-methoxycarbonylphenyl)furan-2-yl]methylamino]hexanoic acid.
| Compound Name | (2S)-2-[[5-(2-methoxycarbonylphenyl)furan-2-yl]methylamino]hexanoic acid |
|---|---|
| PubChem CID | 122044740 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (2S)-2-[[5-(2-methoxycarbonylphenyl)furan-2-yl]methylamino]hexanoic acid |
| SMILES | CCCC[C@H](NCc1ccc(-c2ccccc2C(=O)OC)o1)C(=O)O |
| InChI | InChI=1S/C19H23NO5/c1-3-4-9-16(18(21)22)20-12-13-10-11-17(25-13)14-7-5-6-8-15(14)19(23)24-2/h5-8,10-11,16,20H,3-4,9,12H2,1-2H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | DMHGOHNWALQNJS-INIZCTEOSA-N |
| XLogP | 3.47 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |