C15H20Cl3FN2O — CID 17333119
N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;dihydrochloride (PubChem CID 17333119) has the molecular formula C15H20Cl3FN2O and a molecular weight of 369.70 g/mol. Its IUPAC name is N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17333119 |
| Molecular Formula | C15H20Cl3FN2O |
| Molecular Weight | 369.70 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | N'-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-N-methylpropane-1,3-diamine;dihydrochloride |
| SMILES | CNCCCNCc1ccc(-c2ccc(F)c(Cl)c2)o1.Cl.Cl |
| InChI | InChI=1S/C15H18ClFN2O.2ClH/c1-18-7-2-8-19-10-12-4-6-15(20-12)11-3-5-14(17)13(16)9-11;;/h3-6,9,18-19H,2,7-8,10H2,1H3;2*1H |
| InChIKey | YSHNWBLHNHXXPM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.70 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|