C9H10BBrF3O2- — CID 171374056
(2-bromo-4,5-dimethoxyphenyl)methyl-trifluoroboranuide (PubChem CID 171374056) has the molecular formula C9H10BBrF3O2- and a molecular weight of 297.89 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)methyl-trifluoroboranuide.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 171374056 |
| Molecular Formula | C9H10BBrF3O2- |
| Molecular Weight | 297.89 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)methyl-trifluoroboranuide |
| SMILES | COc1cc(Br)c(C[B-](F)(F)F)cc1OC |
| InChI | InChI=1S/C9H10BBrF3O2/c1-15-8-3-6(5-10(12,13)14)7(11)4-9(8)16-2/h3-4H,5H2,1-2H3/q-1 |
| InChIKey | DIDDXIDEJLUROV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.89 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|