C12H18BrNO4 — CID 82710693
1-(2-bromo-4,5-dimethoxyphenyl)-N-(2-methoxyethoxy)methanamine (PubChem CID 82710693) has the molecular formula C12H18BrNO4 and a molecular weight of 320.18 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethoxyphenyl)-N-(2-methoxyethoxy)methanamine.
| Compound Name | 1-(2-bromo-4,5-dimethoxyphenyl)-N-(2-methoxyethoxy)methanamine |
|---|---|
| PubChem CID | 82710693 |
| Molecular Formula | C12H18BrNO4 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 1-(2-bromo-4,5-dimethoxyphenyl)-N-(2-methoxyethoxy)methanamine |
| SMILES | COCCONCc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C12H18BrNO4/c1-15-4-5-18-14-8-9-6-11(16-2)12(17-3)7-10(9)13/h6-7,14H,4-5,8H2,1-3H3 |
| InChIKey | ONPYJRUEVAVPSH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|