C11H15Br2NO3 — CID 82715534
1-(3,5-dibromo-4-methoxyphenyl)-N-(2-methoxyethoxy)methanamine (PubChem CID 82715534) has the molecular formula C11H15Br2NO3 and a molecular weight of 369.05 g/mol. Its IUPAC name is 1-(3,5-dibromo-4-methoxyphenyl)-N-(2-methoxyethoxy)methanamine.
| Compound Name | 1-(3,5-dibromo-4-methoxyphenyl)-N-(2-methoxyethoxy)methanamine |
|---|---|
| PubChem CID | 82715534 |
| Molecular Formula | C11H15Br2NO3 |
| Molecular Weight | 369.05 g/mol |
| Exact Mass | 366.94 |
| IUPAC Name | 1-(3,5-dibromo-4-methoxyphenyl)-N-(2-methoxyethoxy)methanamine |
| SMILES | COCCONCc1cc(Br)c(OC)c(Br)c1 |
| InChI | InChI=1S/C11H15Br2NO3/c1-15-3-4-17-14-7-8-5-9(12)11(16-2)10(13)6-8/h5-6,14H,3-4,7H2,1-2H3 |
| InChIKey | ZYCXLJGPRMXZGI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.05 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|