C12H16BrNO4 — CID 94212923
(2S)-2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]propanoic acid (PubChem CID 94212923) has the molecular formula C12H16BrNO4 and a molecular weight of 318.17 g/mol. Its IUPAC name is (2S)-2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]propanoic acid.
| Compound Name | (2S)-2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 94212923 |
| Molecular Formula | C12H16BrNO4 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | (2S)-2-[(2-bromo-4,5-dimethoxyphenyl)methylamino]propanoic acid |
| SMILES | COc1cc(Br)c(CN[C@@H](C)C(=O)O)cc1OC |
| InChI | InChI=1S/C12H16BrNO4/c1-7(12(15)16)14-6-8-4-10(17-2)11(18-3)5-9(8)13/h4-5,7,14H,6H2,1-3H3,(H,15,16)/t7-/m0/s1 |
| InChIKey | HGCRRGNUAPYATB-ZETCQYMHSA-N |
| XLogP | 2.03 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |