C18H17Cl2NO2 — CID 52915382
2-[2-(3-chlorophenyl)ethyl]-7-methoxyisoquinolin-2-ium-6-ol chloride (PubChem CID 52915382) has the molecular formula C18H17Cl2NO2 and a molecular weight of 350.25 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)ethyl]-7-methoxyisoquinolin-2-ium-6-ol chloride.
| Compound Name | 2-[2-(3-chlorophenyl)ethyl]-7-methoxyisoquinolin-2-ium-6-ol chloride |
|---|---|
| PubChem CID | 52915382 |
| Molecular Formula | C18H17Cl2NO2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-[2-(3-chlorophenyl)ethyl]-7-methoxyisoquinolin-2-ium-6-ol chloride |
| SMILES | COc1cc2c[n+](CCc3cccc(Cl)c3)ccc2cc1O.[Cl-] |
| InChI | InChI=1S/C18H16ClNO2.ClH/c1-22-18-11-15-12-20(8-6-14(15)10-17(18)21)7-5-13-3-2-4-16(19)9-13;/h2-4,6,8-12H,5,7H2,1H3;1H |
| InChIKey | VCBPWACTQJHGMH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|