C20H22ClNO3 — CID 52915379
6,7-dimethoxy-2-[2-(4-methoxyphenyl)ethyl]isoquinolin-2-ium chloride (PubChem CID 52915379) has the molecular formula C20H22ClNO3 and a molecular weight of 359.85 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[2-(4-methoxyphenyl)ethyl]isoquinolin-2-ium chloride.
| Compound Name | 6,7-dimethoxy-2-[2-(4-methoxyphenyl)ethyl]isoquinolin-2-ium chloride |
|---|---|
| PubChem CID | 52915379 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 6,7-dimethoxy-2-[2-(4-methoxyphenyl)ethyl]isoquinolin-2-ium chloride |
| SMILES | COc1ccc(CC[n+]2ccc3cc(OC)c(OC)cc3c2)cc1.[Cl-] |
| InChI | InChI=1S/C20H22NO3.ClH/c1-22-18-6-4-15(5-7-18)8-10-21-11-9-16-12-19(23-2)20(24-3)13-17(16)14-21;/h4-7,9,11-14H,8,10H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CSGJKPLBPOYWMA-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|