C21H23BrNO4+ — CID 102010459
2-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-7,8-dimethoxyisoquinolin-2-ium (PubChem CID 102010459) has the molecular formula C21H23BrNO4+ and a molecular weight of 433.32 g/mol. Its IUPAC name is 2-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-7,8-dimethoxyisoquinolin-2-ium.
| Compound Name | 2-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-7,8-dimethoxyisoquinolin-2-ium |
|---|---|
| PubChem CID | 102010459 |
| Molecular Formula | C21H23BrNO4+ |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 2-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-7,8-dimethoxyisoquinolin-2-ium |
| SMILES | COc1cc(Br)c(CC[n+]2ccc3ccc(OC)c(OC)c3c2)cc1OC |
| InChI | InChI=1S/C21H23BrNO4/c1-24-18-6-5-14-7-9-23(13-16(14)21(18)27-4)10-8-15-11-19(25-2)20(26-3)12-17(15)22/h5-7,9,11-13H,8,10H2,1-4H3/q+1 |
| InChIKey | PEHMNCURXLZTRE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|