C21H23NO4 — CID 52916704
7,8-dimethoxy-2-[2-(2-methylphenyl)ethyl]isoquinolin-2-ium formate (PubChem CID 52916704) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 7,8-dimethoxy-2-[2-(2-methylphenyl)ethyl]isoquinolin-2-ium formate.
| Compound Name | 7,8-dimethoxy-2-[2-(2-methylphenyl)ethyl]isoquinolin-2-ium formate |
|---|---|
| PubChem CID | 52916704 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 7,8-dimethoxy-2-[2-(2-methylphenyl)ethyl]isoquinolin-2-ium formate |
| SMILES | COc1ccc2cc[n+](CCc3ccccc3C)cc2c1OC.O=C[O-] |
| InChI | InChI=1S/C20H22NO2.CH2O2/c1-15-6-4-5-7-16(15)10-12-21-13-11-17-8-9-19(22-2)20(23-3)18(17)14-21;2-1-3/h4-9,11,13-14H,10,12H2,1-3H3;1H,(H,2,3)/q+1;/p-1 |
| InChIKey | JKZUKPVJIHCOTM-UHFFFAOYSA-M |
| XLogP | 2.06 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|