C19H19Cl2NO3 — CID 42998857
2-[2-(2-chlorophenoxy)ethyl]-6,7-dimethoxyisoquinolin-2-ium chloride (PubChem CID 42998857) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is 2-[2-(2-chlorophenoxy)ethyl]-6,7-dimethoxyisoquinolin-2-ium chloride.
| Compound Name | 2-[2-(2-chlorophenoxy)ethyl]-6,7-dimethoxyisoquinolin-2-ium chloride |
|---|---|
| PubChem CID | 42998857 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 2-[2-(2-chlorophenoxy)ethyl]-6,7-dimethoxyisoquinolin-2-ium chloride |
| SMILES | COc1cc2cc[n+](CCOc3ccccc3Cl)cc2cc1OC.[Cl-] |
| InChI | InChI=1S/C19H19ClNO3.ClH/c1-22-18-11-14-7-8-21(13-15(14)12-19(18)23-2)9-10-24-17-6-4-3-5-16(17)20;/h3-8,11-13H,9-10H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | UGDPGRGVKWNSJR-UHFFFAOYSA-M |
| XLogP | 0.88 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|