C10H7NO3 — CID 11127048
6-oxido-[1,3]dioxolo[4,5-g]isoquinolin-6-ium (PubChem CID 11127048) has the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. Its IUPAC name is 6-oxido-[1,3]dioxolo[4,5-g]isoquinolin-6-ium.
| Compound Name | 6-oxido-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
|---|---|
| PubChem CID | 11127048 |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 6-oxido-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
| SMILES | [O-][n+]1ccc2cc3c(cc2c1)OCO3 |
| InChI | InChI=1S/C10H7NO3/c12-11-2-1-7-3-9-10(14-6-13-9)4-8(7)5-11/h1-5H,6H2 |
| InChIKey | RBPKXITZHIMGNY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|