About 2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum
2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum (PubChem CID 135997447) has the molecular formula C19H15Cl3NOSTa
and a molecular weight of 592.71 g/mol. Its IUPAC name is 2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum.
Molecular Properties
| Compound Name | 2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum |
| PubChem CID | 135997447 |
| Molecular Formula | C19H15Cl3NOSTa |
| Molecular Weight | 592.71 g/mol |
| Exact Mass | 590.94 |
| IUPAC Name | 2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum |
| SMILES | Cl[Ta](Cl)Cl.Oc1c(/C=N/c2ccccc2)cccc1Sc1ccccc1 |
| InChI | InChI=1S/C19H15NOS.3ClH.Ta/c21-19-15(14-20-16-9-3-1-4-10-16)8-7-13-18(19)22-17-11-5-2-6-12-17;;;;/h1-14,21H;3*1H;/q;;;;+3/p-3/b20-14+;;;; |
| InChIKey | BACOCTXBLWWCGY-JKPNHNRMSA-K |
| XLogP | 7.36 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.71 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum?
The IUPAC name of 2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum (CID 135997447) is 2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum.
What is the SMILES notation for 2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum?
The canonical SMILES for 2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum is Cl[Ta](Cl)Cl.Oc1c(/C=N/c2ccccc2)cccc1Sc1ccccc1.
What is the InChIKey of 2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum?
The InChIKey is BACOCTXBLWWCGY-JKPNHNRMSA-K. The full InChI is InChI=1S/C19H15NOS.3ClH.Ta/c21-19-15(14-20-16-9-3-1-4-10-16)8-7-13-18(19)22-17-11-5-2-6-12-17;;;;/h1-14,21H;3*1H;/q;;;;+3/p-3/b20-14+;;;;.
What are the key properties of 2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum?
2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum has a molecular weight of 592.71 g/mol, XLogP of 7.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(phenyliminomethyl)-6-phenylsulfanylphenol;trichlorotantalum is sourced from PubChem (CID 135997447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).