C15H11NO5 — CID 174908564
2-[(2-hydroxyphenyl)methylideneamino]benzene-1,3-dicarboxylic acid (PubChem CID 174908564) has the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. Its IUPAC name is 2-[(2-hydroxyphenyl)methylideneamino]benzene-1,3-dicarboxylic acid.
| Compound Name | 2-[(2-hydroxyphenyl)methylideneamino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174908564 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-[(2-hydroxyphenyl)methylideneamino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cccc(C(=O)O)c1/N=C/c1ccccc1O |
| InChI | InChI=1S/C15H11NO5/c17-12-7-2-1-4-9(12)8-16-13-10(14(18)19)5-3-6-11(13)15(20)21/h1-8,17H,(H,18,19)(H,20,21)/b16-8+ |
| InChIKey | XCKHBTOSJTVPPZ-LZYBPNLTSA-N |
| XLogP | 2.54 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|