C14H9F2NO2 — CID 23333881
2-[(2,3-difluorophenyl)methylideneamino]benzoic acid (PubChem CID 23333881) has the molecular formula C14H9F2NO2 and a molecular weight of 261.23 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methylideneamino]benzoic acid.
| Compound Name | 2-[(2,3-difluorophenyl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 23333881 |
| Molecular Formula | C14H9F2NO2 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methylideneamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1/N=C/c1cccc(F)c1F |
| InChI | InChI=1S/C14H9F2NO2/c15-11-6-3-4-9(13(11)16)8-17-12-7-2-1-5-10(12)14(18)19/h1-8H,(H,18,19)/b17-8+ |
| InChIKey | ZTKIQOKGPBCNOF-CAOOACKPSA-N |
| XLogP | 3.41 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|