C24H18N2O5 — CID 102580830
2-[[2-(1-acetyl-4-oxo-2H-3,1-benzoxazin-2-yl)phenyl]methylideneamino]benzoic acid (PubChem CID 102580830) has the molecular formula C24H18N2O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is 2-[[2-(1-acetyl-4-oxo-2H-3,1-benzoxazin-2-yl)phenyl]methylideneamino]benzoic acid.
| Compound Name | 2-[[2-(1-acetyl-4-oxo-2H-3,1-benzoxazin-2-yl)phenyl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 102580830 |
| Molecular Formula | C24H18N2O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-[[2-(1-acetyl-4-oxo-2H-3,1-benzoxazin-2-yl)phenyl]methylideneamino]benzoic acid |
| SMILES | CC(=O)N1c2ccccc2C(=O)OC1c1ccccc1/C=N\c1ccccc1C(=O)O |
| InChI | InChI=1S/C24H18N2O5/c1-15(27)26-21-13-7-5-11-19(21)24(30)31-22(26)17-9-3-2-8-16(17)14-25-20-12-6-4-10-18(20)23(28)29/h2-14,22H,1H3,(H,28,29)/b25-14- |
| InChIKey | XCPCNQCLKJZSFK-QFEZKATASA-N |
| XLogP | 4.36 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|