C14H10F2N2O — CID 175437283
3-[(2,3-difluorophenyl)methylideneamino]benzamide (PubChem CID 175437283) has the molecular formula C14H10F2N2O and a molecular weight of 260.24 g/mol. Its IUPAC name is 3-[(2,3-difluorophenyl)methylideneamino]benzamide.
| Compound Name | 3-[(2,3-difluorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 175437283 |
| Molecular Formula | C14H10F2N2O |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-[(2,3-difluorophenyl)methylideneamino]benzamide |
| SMILES | NC(=O)c1cccc(/N=C/c2cccc(F)c2F)c1 |
| InChI | InChI=1S/C14H10F2N2O/c15-12-6-2-4-10(13(12)16)8-18-11-5-1-3-9(7-11)14(17)19/h1-8H,(H2,17,19)/b18-8+ |
| InChIKey | GAAGGNWVYLXLGU-QGMBQPNBSA-N |
| XLogP | 2.81 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|