C20H18F2N6S — CID 169086252
2-[1-[2-[3-[(2,3-difluorophenyl)methylideneamino]phenyl]-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine (PubChem CID 169086252) has the molecular formula C20H18F2N6S and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-[1-[2-[3-[(2,3-difluorophenyl)methylideneamino]phenyl]-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine.
| Compound Name | 2-[1-[2-[3-[(2,3-difluorophenyl)methylideneamino]phenyl]-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 169086252 |
| Molecular Formula | C20H18F2N6S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 2-[1-[2-[3-[(2,3-difluorophenyl)methylideneamino]phenyl]-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine |
| SMILES | CC(=NN=C(N)N)c1sc(-c2cccc(/N=C/c3cccc(F)c3F)c2)nc1C |
| InChI | InChI=1S/C20H18F2N6S/c1-11-18(12(2)27-28-20(23)24)29-19(26-11)13-5-3-7-15(9-13)25-10-14-6-4-8-16(21)17(14)22/h3-10H,1-2H3,(H4,23,24,28)/b25-10+,27-12? |
| InChIKey | SGJZLKKHQHQWHG-SSDLKQFISA-N |
| XLogP | 4.14 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|